* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX125061 |
English Synonyms: | WUXIAPPTEC WX125061 |
MDL Number.: | MFCD18792133 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(C)(C)OC(=O)N1CC2CCC1c3c2nc(nc3)SC |
InChi: | InChI=1S/C15H21N3O2S/c1-15(2,3)20-14(19)18-8-9-5-6-11(18)10-7-16-13(21-4)17-12(9)10/h7,9,11H,5-6,8H2,1-4H3 |
InChiKey: | InChIKey=KSSNGLBVKSSMMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.