* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX125141 |
English Synonyms: | WUXIAPPTEC WX125141 |
MDL Number.: | MFCD18792140 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)C12Cc3ccccc3C(C1)CNC2=O |
InChi: | InChI=1S/C15H17NO3/c1-2-19-14(18)15-7-10-5-3-4-6-12(10)11(8-15)9-16-13(15)17/h3-6,11H,2,7-9H2,1H3,(H,16,17) |
InChiKey: | InChIKey=VOJSVBDOUBJTDF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.