* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX140864 |
English Synonyms: | WUXIAPPTEC WX140864 |
MDL Number.: | MFCD18792925 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CCOC(=O)C1Cn2cnc(c2CN(C1)C(=O)OC(C)(C)C)Br |
InChi: | InChI=1S/C15H22BrN3O4/c1-5-22-13(20)10-6-18(14(21)23-15(2,3)4)8-11-12(16)17-9-19(11)7-10/h9-10H,5-8H2,1-4H3 |
InChiKey: | InChIKey=XXQDDGYSUZFUIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.