* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110551 |
English Synonyms: | WUXIAPPTEC WX110551 |
MDL Number.: | MFCD18792929 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CC(C)(C)OC(=O)N1C[C@@H]2CN(C[C@@H]2C1C(=O)OC)C(=O)OCc3ccccc3 |
InChi: | InChI=1S/C21H28N2O6/c1-21(2,3)29-20(26)23-11-15-10-22(12-16(15)17(23)18(24)27-4)19(25)28-13-14-8-6-5-7-9-14/h5-9,15-17H,10-13H2,1-4H3/t15-,16-,17?/m0/s1 |
InChiKey: | InChIKey=CUBZUXAZVLHIEF-PYNWJHIZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.