* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-9H-PYRIDO[3,4-B]INDOLE |
CAS: | 316125-14-1 |
English Synonyms: | 8-CHLORO-9H-PYRIDO[3,4-B]INDOLE |
MDL Number.: | MFCD18803777 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc2c3ccncc3[nH]c2c(c1)Cl |
InChi: | InChI=1S/C11H7ClN2/c12-9-3-1-2-8-7-4-5-13-6-10(7)14-11(8)9/h1-6,14H |
InChiKey: | InChIKey=FQDLUTLQTIXNKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.