* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9H-PYRIDO[3,4-B]INDOLE-1-CARBONITRILE |
| CAS: | 79960-43-3 |
| English Synonyms: | 9H-PYRIDO[3,4-B]INDOLE-1-CARBONITRILE |
| MDL Number.: | MFCD18803831 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c3ccnc(c3[nH]2)C#N |
| InChi: | InChI=1S/C12H7N3/c13-7-11-12-9(5-6-14-11)8-3-1-2-4-10(8)15-12/h1-6,15H |
| InChiKey: | InChIKey=WKTIQIMSHWNROR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.