* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHYL-9H-PYRIDO[3,4-B]INDOLE |
CAS: | 30684-49-2 |
English Synonyms: | 8-METHYL-9H-PYRIDO[3,4-B]INDOLE |
MDL Number.: | MFCD18803845 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cccc2c1[nH]c3c2ccnc3 |
InChi: | InChI=1S/C12H10N2/c1-8-3-2-4-10-9-5-6-13-7-11(9)14-12(8)10/h2-7,14H,1H3 |
InChiKey: | InChIKey=VQTGMRLUNMTCDX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.