* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9H-PYRIDO[3,4-B]INDOLE-1-CARBOXYLIC ACID |
| CAS: | 26052-96-0 |
| English Synonyms: | 9H-PYRIDO[3,4-B]INDOLE-1-CARBOXYLIC ACID |
| MDL Number.: | MFCD18803849 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c3ccnc(c3[nH]2)C(=O)O |
| InChi: | InChI=1S/C12H8N2O2/c15-12(16)11-10-8(5-6-13-11)7-3-1-2-4-9(7)14-10/h1-6,14H,(H,15,16) |
| InChiKey: | InChIKey=VNPNEGORDFERGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.