* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHOXY-3-METHYL-9H-PYRIDO[2,3-B]INDOLE |
CAS: | 1005498-13-4 |
English Synonyms: | 8-METHOXY-3-METHYL-9H-PYRIDO[2,3-B]INDOLE |
MDL Number.: | MFCD18803892 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc2c3cccc(c3[nH]c2nc1)OC |
InChi: | InChI=1S/C13H12N2O/c1-8-6-10-9-4-3-5-11(16-2)12(9)15-13(10)14-7-8/h3-7H,1-2H3,(H,14,15) |
InChiKey: | InChIKey=ZMXGNFCPQZWGCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.