* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHOXY-2H-1,3-BENZOXAZIN-2-ONE |
CAS: | 501952-77-8 |
English Synonyms: | 2H-1,3-BENZOXAZIN-2-ONE, 8-METHOXY- ; 8-METHOXY-2H-1,3-BENZOXAZIN-2-ONE |
MDL Number.: | MFCD18814160 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1cccc2c1oc(=O)nc2 |
InChi: | InChI=1S/C9H7NO3/c1-12-7-4-2-3-6-5-10-9(11)13-8(6)7/h2-5H,1H3 |
InChiKey: | InChIKey=DVUBJHXHEREDLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.