* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2H-CYCLONON[D]ISOXAZOLE |
| CAS: | 105066-28-2 |
| English Synonyms: | 2H-CYCLONON[D]ISOXAZOLE |
| MDL Number.: | MFCD18814525 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c\1c\cc/c\2c[nH]o/c2c\cc1 |
| InChi: | InChI=1S/C10H9NO/c1-2-4-6-9-8-11-12-10(9)7-5-3-1/h1-8,11H/b2-1-,5-3-,6-4-,10-7+ |
| InChiKey: | InChIKey=SIGSHFLWZQBCRL-NKBKKBNQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.