* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8H-INDENO[1,2-D]ISOXAZOLE |
| CAS: | 319-10-8 |
| English Synonyms: | 8H-INDENO[1,2-D]ISOXAZOLE |
| MDL Number.: | MFCD18823016 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1c2=C3CC=CC=C3C=c2on1 |
| InChi: | InChI=1S/C10H7NO/c1-2-4-8-7(3-1)5-10-9(8)6-11-12-10/h1-3,5-6H,4H2 |
| InChiKey: | InChIKey=LOXPUAGWPRVFNA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.