* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-OXABICYCLO[5.1.0]OCTAN-4-ONE |
English Synonyms: | 8-OXABICYCLO[5.1.0]OCTAN-4-ONE |
MDL Number.: | MFCD18823058 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CC(=O)CCC2C1O2 |
InChi: | InChI=1S/C7H10O2/c8-5-1-3-6-7(9-6)4-2-5/h6-7H,1-4H2 |
InChiKey: | InChIKey=JYNJEHKETRJGQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.