* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-ETHYL-1,3,4,10-TETRAHYDRO-9(2H)-ANTHRACENONE |
| CAS: | 767340-63-6 |
| English Synonyms: | 7-ETHYL-1,3,4,10-TETRAHYDRO-9(2H)-ANTHRACENONE ; 9(2H)-ANTHRACENONE, 7-ETHYL-1,3,4,10-TETRAHYDRO- |
| MDL Number.: | MFCD18823108 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCc1ccc2c(c1)C(=O)C3=C(C2)CCCC3 |
| InChi: | InChI=1S/C16H18O/c1-2-11-7-8-13-10-12-5-3-4-6-14(12)16(17)15(13)9-11/h7-9H,2-6,10H2,1H3 |
| InChiKey: | InChIKey=JSCIDMPHSSOALH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.