* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(1-METHYLETHYL)-9-AZABICYCLO[6.1.0]NON-4-ENE |
| CAS: | 64776-25-6 |
| English Synonyms: | 9-AZABICYCLO[6.1.0]NON-4-ENE, 9-(1-METHYLETHYL)- ; 9-(1-METHYLETHYL)-9-AZABICYCLO[6.1.0]NON-4-ENE |
| MDL Number.: | MFCD18823135 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)N1C2C1CC/C=C\CC2 |
| InChi: | InChI=1S/C11H19N/c1-9(2)12-10-7-5-3-4-6-8-11(10)12/h3-4,9-11H,5-8H2,1-2H3/b4-3- |
| InChiKey: | InChIKey=NWIGSARYJOOZBD-ARJAWSKDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.