* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-ETHENYL-9H-PURIN-6-AMINE |
CAS: | 942950-89-2 |
English Synonyms: | 8-ETHENYL-9H-PURIN-6-AMINE |
MDL Number.: | MFCD18823176 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C=Cc1[nH]c2c(n1)c(ncn2)N |
InChi: | InChI=1S/C7H7N5/c1-2-4-11-5-6(8)9-3-10-7(5)12-4/h2-3H,1H2,(H3,8,9,10,11,12) |
InChiKey: | InChIKey=JPEPBVPTZSCEQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.