* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (1R,2R,3R,4S)-BICYCLO[2.2.1]HEPTANE-2,3-DIAMINE |
| CAS: | 741668-23-5 |
| English Synonyms: | (1R,2R,3R,4S)-BICYCLO[2.2.1]HEPTANE-2,3-DIAMINE ; BICYCLO[2.2.1]HEPTANE-2,3-DIAMINE, (1R,2R,3R,4S)- |
| MDL Number.: | MFCD18826836 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | C1C[C@@H]2C[C@H]1[C@H]([C@@H]2N)N |
| InChi: | InChI=1S/C7H14N2/c8-6-4-1-2-5(3-4)7(6)9/h4-7H,1-3,8-9H2/t4-,5+,6-,7-/m1/s1 |
| InChiKey: | InChIKey=ZPKDUFWKBQYUAT-XZBKPIIZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.