* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3,5-PIPERIDINEDIOL, 2-(HYDROXYMETHYL)-, (2S,3S,5S)- |
CAS: | 561285-40-3 |
English Synonyms: | 3,5-PIPERIDINEDIOL, 2-(HYDROXYMETHYL)-, (2S,3S,5S)- |
MDL Number.: | MFCD18828351 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | C1[C@@H](CN[C@H]([C@H]1O)CO)O |
InChi: | InChI=1S/C6H13NO3/c8-3-5-6(10)1-4(9)2-7-5/h4-10H,1-3H2/t4-,5-,6-/m0/s1 |
InChiKey: | InChIKey=DFTXSEFXOMEDNU-ZLUOBGJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.