* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXIRANECARBOXALDEHYDE, 3-PHENYL-, (2R,3S)- |
| CAS: | 126720-47-6 |
| English Synonyms: | OXIRANECARBOXALDEHYDE, 3-PHENYL-, (2R,3S)- |
| MDL Number.: | MFCD18828611 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)[C@H]2[C@@H](O2)C=O |
| InChi: | InChI=1S/C9H8O2/c10-6-8-9(11-8)7-4-2-1-3-5-7/h1-6,8-9H/t8-,9-/m0/s1 |
| InChiKey: | InChIKey=MNDACYSEJXGHML-IUCAKERBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.