* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-BUTEN-2-ONE, 4-CYCLOPROPYL- |
CAS: | 54139-51-4 |
English Synonyms: | 3-BUTEN-2-ONE, 4-CYCLOPROPYL- ; 4-CYCLOPROPYL-3-BUTEN-2-ONE |
MDL Number.: | MFCD18829026 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(=O)/C=C\C1CC1 |
InChi: | InChI=1S/C7H10O/c1-6(8)2-3-7-4-5-7/h2-3,7H,4-5H2,1H3/b3-2- |
InChiKey: | InChIKey=AKBUQKWXWWDVNF-IHWYPQMZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.