* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3E)-3-ETHYL-3-PENTEN-2-ONE |
CAS: | 52883-76-8 |
English Synonyms: | 3-PENTEN-2-ONE, 3-ETHYL-, (E)- ; (3E)-3-ETHYL-3-PENTEN-2-ONE ; (E)-3-ETHYL-3-PENTEN-2-ONE |
MDL Number.: | MFCD18829050 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC/C(=C\C)/C(=O)C |
InChi: | InChI=1S/C7H12O/c1-4-7(5-2)6(3)8/h4H,5H2,1-3H3/b7-4+ |
InChiKey: | InChIKey=KRJQGIMOLPOGQY-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.