* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | HEXANAL, 2-ETHYL-5-OXO-, (2R)- |
CAS: | 553638-68-9 |
English Synonyms: | HEXANAL, 2-ETHYL-5-OXO-, (2R)- |
MDL Number.: | MFCD18829367 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[C@H](CCC(=O)C)C=O |
InChi: | InChI=1S/C8H14O2/c1-3-8(6-9)5-4-7(2)10/h6,8H,3-5H2,1-2H3/t8-/m1/s1 |
InChiKey: | InChIKey=QQYSXJCCOWNSSH-MRVPVSSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.