* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-INDOLIZINOL, OCTAHYDRO-, (8S,8AS)- |
CAS: | 512171-71-0 |
English Synonyms: | 8-INDOLIZINOL, OCTAHYDRO-, (8S,8AS)- |
MDL Number.: | MFCD18830104 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1C[C@H]2[C@H](CCCN2C1)O |
InChi: | InChI=1S/C8H15NO/c10-8-4-2-6-9-5-1-3-7(8)9/h7-8,10H,1-6H2/t7-,8-/m0/s1 |
InChiKey: | InChIKey=GJTUCATUYQZTJZ-YUMQZZPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.