* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-AZABICYCLO[3.2.1]OCT-3-ENE-2-CARBOXYLIC ACID, 8-METHYL-, (1R)- |
CAS: | 786577-75-1 |
English Synonyms: | 8-AZABICYCLO[3.2.1]OCT-3-ENE-2-CARBOXYLIC ACID, 8-METHYL-, (1R)- |
MDL Number.: | MFCD18830382 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN1C2CC[C@@H]1C(C=C2)C(=O)O |
InChi: | InChI=1S/C9H13NO2/c1-10-6-2-4-7(9(11)12)8(10)5-3-6/h2,4,6-8H,3,5H2,1H3,(H,11,12)/t6?,7?,8-/m1/s1 |
InChiKey: | InChIKey=BBBNTRDOFVZKBT-KAVNDROISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.