* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-THIAZOLIDINONE, 4-METHOXY-5-(2-PROPENYL)-, (4S,5S)- |
CAS: | 515143-25-6 |
English Synonyms: | 2-THIAZOLIDINONE, 4-METHOXY-5-(2-PROPENYL)-, (4S,5S)- |
MDL Number.: | MFCD18831185 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CO[C@H]1[C@@H](SC(=O)N1)CC=C |
InChi: | InChI=1S/C7H11NO2S/c1-3-4-5-6(10-2)8-7(9)11-5/h3,5-6H,1,4H2,2H3,(H,8,9)/t5-,6-/m0/s1 |
InChiKey: | InChIKey=FRYKMPHISTVBOM-WDSKDSINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.