* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(1-CYCLOHEXEN-1-YL)-2,2-DIETHYL-2,5-DIHYDRO-FURAN |
CAS: | 586346-14-7 |
English Synonyms: | 5-(1-CYCLOHEXEN-1-YL)-2,2-DIETHYL-2,5-DIHYDRO-FURAN ; FURAN, 5-(1-CYCLOHEXEN-1-YL)-2,2-DIETHYL-2,5-DIHYDRO- |
MDL Number.: | MFCD18832060 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCC1(C=CC(O1)C2=CCCCC2)CC |
InChi: | InChI=1S/C14H22O/c1-3-14(4-2)11-10-13(15-14)12-8-6-5-7-9-12/h8,10-11,13H,3-7,9H2,1-2H3 |
InChiKey: | InChIKey=RRKHYCWXFSNVQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.