* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-MORPHOLINEMETHANOL, 5-(1-METHYLETHYL)-, (3R,5S)- |
CAS: | 500708-43-0 |
English Synonyms: | 3-MORPHOLINEMETHANOL, 5-(1-METHYLETHYL)-, (3R,5S)- |
MDL Number.: | MFCD18832373 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)[C@H]1COC[C@H](N1)CO |
InChi: | InChI=1S/C8H17NO2/c1-6(2)8-5-11-4-7(3-10)9-8/h6-10H,3-5H2,1-2H3/t7-,8-/m1/s1 |
InChiKey: | InChIKey=HWOVXSYKAXNDRJ-HTQZYQBOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.