* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CYCLOHEPTEN-1-ONE, 7-HYDROXY-5-(1-METHYLETHYL)-, (5S)- |
| CAS: | 310905-94-3 |
| English Synonyms: | 2-CYCLOHEPTEN-1-ONE, 7-HYDROXY-5-(1-METHYLETHYL)-, (5S)- |
| MDL Number.: | MFCD18832475 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)[C@H]1CC=CC(=O)C(C1)O |
| InChi: | InChI=1S/C10H16O2/c1-7(2)8-4-3-5-9(11)10(12)6-8/h3,5,7-8,10,12H,4,6H2,1-2H3/t8-,10?/m0/s1 |
| InChiKey: | InChIKey=BDMJXOUQTUYKSE-PEHGTWAWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.