* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOHEXANONE, 2-FLUORO-2-METHYL-5-(1-METHYLETHYL)-, (2S,5R)- |
| CAS: | 272114-51-9 |
| English Synonyms: | CYCLOHEXANONE, 2-FLUORO-2-METHYL-5-(1-METHYLETHYL)-, (2S,5R)- |
| MDL Number.: | MFCD18832559 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)[C@@H]1CC[C@](C(=O)C1)(C)F |
| InChi: | InChI=1S/C10H17FO/c1-7(2)8-4-5-10(3,11)9(12)6-8/h7-8H,4-6H2,1-3H3/t8-,10+/m1/s1 |
| InChiKey: | InChIKey=NGBYMFOAIMGBPC-SCZZXKLOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.