* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SPIRO[4.5]DEC-9-EN-6-OL, 6,10-DIMETHYL-2-(1-METHYLETHENYL)-, (2R,5R,6S)- |
| CAS: | 791835-48-8 |
| English Synonyms: | SPIRO[4.5]DEC-9-EN-6-OL, 6,10-DIMETHYL-2-(1-METHYLETHENYL)-, (2R,5R,6S)- |
| MDL Number.: | MFCD18832760 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC1=CCC[C@]([C@@]12CC[C@H](C2)C(=C)C)(C)O |
| InChi: | InChI=1S/C15H24O/c1-11(2)13-7-9-15(10-13)12(3)6-5-8-14(15,4)16/h6,13,16H,1,5,7-10H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChiKey: | InChIKey=FXKTVCVHCJAWAM-QLFBSQMISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.