* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYLENE-SPIRO[5.5]UNDEC-1-EN-3-ONE |
| CAS: | 780789-87-9 |
| English Synonyms: | 8-METHYLENE-SPIRO[5.5]UNDEC-1-EN-3-ONE ; SPIRO[5.5]UNDEC-1-EN-3-ONE, 8-METHYLENE- |
| MDL Number.: | MFCD18832842 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C=C1CCCC2(C1)CCC(=O)C=C2 |
| InChi: | InChI=1S/C12H16O/c1-10-3-2-6-12(9-10)7-4-11(13)5-8-12/h4,7H,1-3,5-6,8-9H2 |
| InChiKey: | InChIKey=HKASATPGIZKJRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.