* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-OXABICYCLO[3.2.1]OCTANE-6-ACETIC ACID, 3-OXO-, METHYL ESTER, (1R,5R,6R)- |
| CAS: | 802911-61-1 |
| English Synonyms: | 2-OXABICYCLO[3.2.1]OCTANE-6-ACETIC ACID, 3-OXO-, METHYL ESTER, (1R,5R,6R)- |
| MDL Number.: | MFCD18833024 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COC(=O)C[C@H]1C[C@H]2C[C@@H]1CC(=O)O2 |
| InChi: | InChI=1S/C10H14O4/c1-13-9(11)4-6-2-8-3-7(6)5-10(12)14-8/h6-8H,2-5H2,1H3/t6-,7-,8+/m1/s1 |
| InChiKey: | InChIKey=CGLAYQDWBWSPQV-PRJMDXOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.