* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4,7,8,9,10-OCTAHYDRO-PYRAZINO[1,2-B]INDAZOLE |
CAS: | 561299-73-8 |
English Synonyms: | PYRAZINO[1,2-B]INDAZOLE, 1,2,3,4,7,8,9,10-OCTAHYDRO- ; 1,2,3,4,7,8,9,10-OCTAHYDRO-PYRAZINO[1,2-B]INDAZOLE |
MDL Number.: | MFCD18833280 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CCc2c(c3n(n2)CCNC3)C1 |
InChi: | InChI=1S/C10H15N3/c1-2-4-9-8(3-1)10-7-11-5-6-13(10)12-9/h11H,1-7H2 |
InChiKey: | InChIKey=KQSLFBRHFLYNOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.