* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMIDAZO[1,5-A]QUINOXALIN-4(5H)-ONE |
| CAS: | 179042-26-3 |
| English Synonyms: | IMIDAZO[1,5-A]QUINOXALIN-4(5H)-ONE ; 4H,5H-IMIDAZO[1,5-A]QUINOXALIN-4-ONE |
| MDL Number.: | MFCD18833354 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)[nH]c(=O)c3n2cnc3 |
| InChi: | InChI=1S/C10H7N3O/c14-10-9-5-11-6-13(9)8-4-2-1-3-7(8)12-10/h1-6H,(H,12,14) |
| InChiKey: | InChIKey=JYZUDVSNYNWXHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.