* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2(1H)-PYRIDINETHIONE,6-AMINO- |
| CAS: | 38240-17-4 |
| English Synonyms: | 2(1H)-PYRIDINETHIONE,6-AMINO- ; 6-AMINO-2(1H)-PYRIDINETHIONE |
| MDL Number.: | MFCD18833504 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc([nH]c(=S)c1)N |
| InChi: | InChI=1S/C5H6N2S/c6-4-2-1-3-5(8)7-4/h1-3H,(H3,6,7,8) |
| InChiKey: | InChIKey=IRMILVGRVWZEOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.