* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-AZETIDINONE, 3-AMINO-4-METHYL-, (3R,4R)- |
| CAS: | 745074-59-3 |
| English Synonyms: | 2-AZETIDINONE, 3-AMINO-4-METHYL-, (3R,4R)- |
| MDL Number.: | MFCD18833608 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C[C@@H]1[C@H](C(=O)N1)N |
| InChi: | InChI=1S/C4H8N2O/c1-2-3(5)4(7)6-2/h2-3H,5H2,1H3,(H,6,7)/t2-,3-/m1/s1 |
| InChiKey: | InChIKey=HEKIBZBEXRTFRP-PWNYCUMCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.