* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4H-1,2,3-TRIAZOLO[4,5-C]PYRIDIN-4-ONE, 1,5-DIHYDRO-, HYDRAZONE |
CAS: | 3247-53-8 |
English Synonyms: | 4H-1,2,3-TRIAZOLO[4,5-C]PYRIDIN-4-ONE, 1,5-DIHYDRO-, HYDRAZONE |
MDL Number.: | MFCD18833780 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1c[nH]/c(=N/N)/c2c1[nH]nn2 |
InChi: | InChI=1S/C5H6N6/c6-8-5-4-3(1-2-7-5)9-11-10-4/h1-2H,6H2,(H,7,8)(H,9,10,11) |
InChiKey: | InChIKey=IOGORBABYHAVBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.