* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-HEXENEDIOIC ACID, 5-AMINO-, (2E,5S)- |
| CAS: | 443650-31-5 |
| English Synonyms: | 2-HEXENEDIOIC ACID, 5-AMINO-, (2E,5S)- |
| MDL Number.: | MFCD18834355 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C(/C=C/C(=O)O)[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C6H9NO4/c7-4(6(10)11)2-1-3-5(8)9/h1,3-4H,2,7H2,(H,8,9)(H,10,11)/b3-1+/t4-/m0/s1 |
| InChiKey: | InChIKey=LYOPDUCVDCRVNW-REJIZHKJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.