* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-AZABICYCLO[3.1.0]HEXANE-2,3-DIOL, 4-(HYDROXYMETHYL)-, (1R,2R,3R,4R,5R)- |
CAS: | 540776-09-8 |
English Synonyms: | 6-AZABICYCLO[3.1.0]HEXANE-2,3-DIOL, 4-(HYDROXYMETHYL)-, (1R,2R,3R,4R,5R)- |
MDL Number.: | MFCD18834407 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | C([C@H]1[C@@H]2[C@@H](N2)[C@H]([C@@H]1O)O)O |
InChi: | InChI=1S/C6H11NO3/c8-1-2-3-4(7-3)6(10)5(2)9/h2-10H,1H2/t2-,3+,4+,5+,6+/m0/s1 |
InChiKey: | InChIKey=SXRBQPPVANNBHT-YDMGZANHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.