* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,7-METHANO-1H-INDEN-5-OL, 3A,4,5,6,7,7A-HEXAHYDRO-, (3AR,4R,5S,7R,7AR)- |
CAS: | 501929-84-6 |
English Synonyms: | 4,7-METHANO-1H-INDEN-5-OL, 3A,4,5,6,7,7A-HEXAHYDRO-, (3AR,4R,5S,7R,7AR)- |
MDL Number.: | MFCD18834439 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1C=C[C@@H]2[C@H]1[C@@H]3C[C@H]2[C@H](C3)O |
InChi: | InChI=1S/C10H14O/c11-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-11H,2,4-5H2/t6-,7-,8-,9-,10+/m1/s1 |
InChiKey: | InChIKey=LDUKQFUHJZHLRC-IGORNWKESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.