* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-INDOLIZINEETHANOL, 5,6,7,8-TETRAHYDRO-, (8R)- |
CAS: | 677005-72-0 |
English Synonyms: | 8-INDOLIZINEETHANOL, 5,6,7,8-TETRAHYDRO-, (8R)- |
MDL Number.: | MFCD18835253 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc2n(c1)CCC[C@@H]2CCO |
InChi: | InChI=1S/C10H15NO/c12-8-5-9-3-1-6-11-7-2-4-10(9)11/h2,4,7,9,12H,1,3,5-6,8H2/t9-/m1/s1 |
InChiKey: | InChIKey=YPCMYAYYUWEZLI-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.