* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINOLINE, 6-ETHOXY-1,2,3,4-TETRAHYDRO-2,2,4-TRIMETHYL-, (4R)- |
CAS: | 212186-67-9 |
English Synonyms: | QUINOLINE, 6-ETHOXY-1,2,3,4-TETRAHYDRO-2,2,4-TRIMETHYL-, (4R)- |
MDL Number.: | MFCD18835872 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCOc1ccc2c(c1)[C@@H](CC(N2)(C)C)C |
InChi: | InChI=1S/C14H21NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-8,10,15H,5,9H2,1-4H3/t10-/m1/s1 |
InChiKey: | InChIKey=YLDDCEXDGNXCIO-SNVBAGLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.