* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-OXAZOLIDINONE, 4-[2-(1-ETHYL-1H-PYRROL-2-YL)ETHENYL]-4-METHYL-, (4R)- |
CAS: | 566938-46-3 |
English Synonyms: | 2-OXAZOLIDINONE, 4-[2-(1-ETHYL-1H-PYRROL-2-YL)ETHENYL]-4-METHYL-, (4R)- |
MDL Number.: | MFCD18835955 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1cccc1/C=C\[C@@]2(COC(=O)N2)C |
InChi: | InChI=1S/C12H16N2O2/c1-3-14-8-4-5-10(14)6-7-12(2)9-16-11(15)13-12/h4-8H,3,9H2,1-2H3,(H,13,15)/b7-6-/t12-/m1/s1 |
InChiKey: | InChIKey=NQXCIJIGWGZEET-ZHRWSRJISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.