* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (3S)-3-(PROPAN-2-YL)CYCLOHEPTAN-1-ONE |
| CAS: | 329324-90-5 |
| English Synonyms: | (3S)-3-(PROPAN-2-YL)CYCLOHEPTAN-1-ONE ; CYCLOHEPTANONE, 3-(1-METHYLETHYL)-, (3S)- |
| MDL Number.: | MFCD18836001 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(C)[C@H]1CCCCC(=O)C1 |
| InChi: | InChI=1S/C10H18O/c1-8(2)9-5-3-4-6-10(11)7-9/h8-9H,3-7H2,1-2H3/t9-/m0/s1 |
| InChiKey: | InChIKey=FADJMQQFGSBLND-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.