* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4(1H)-PTERIDINONE, 6,7-DIHYDRO-2,7-DIMETHYL- |
| CAS: | 124613-05-4 |
| English Synonyms: | 4(1H)-PTERIDINONE, 6,7-DIHYDRO-2,7-DIMETHYL- ; 6,7-DIHYDRO-2,7-DIMETHYL-4(1H)-PTERIDINONE |
| MDL Number.: | MFCD18836338 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1[nH]c2=NC(CN=c2c(=O)n1)C |
| InChi: | InChI=1S/C8H10N4O/c1-4-3-9-6-7(10-4)11-5(2)12-8(6)13/h4H,3H2,1-2H3,(H,10,11,12,13) |
| InChiKey: | InChIKey=KBTXBYSFGHNGLR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.