* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHYL-THIENO[2,3-C]PYRIDIN-4-OL |
| CAS: | 73224-09-6 |
| English Synonyms: | THIENO[2,3-C]PYRIDIN-4-OL, 7-METHYL- ; 7-METHYL-THIENO[2,3-C]PYRIDIN-4-OL |
| MDL Number.: | MFCD18836498 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1c2c(ccs2)c(cn1)O |
| InChi: | InChI=1S/C8H7NOS/c1-5-8-6(2-3-11-8)7(10)4-9-5/h2-4,10H,1H3 |
| InChiKey: | InChIKey=VVQWCTNFIKQXSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.