* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(BUT-3-YN-1-YLOXY)QUINOLIN-5-AMINE |
English Synonyms: | 8-(BUT-3-YN-1-YLOXY)QUINOLIN-5-AMINE |
MDL Number.: | MFCD18851223 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C#CCCOc1ccc(c2c1nccc2)N |
InChi: | InChI=1S/C13H12N2O/c1-2-3-9-16-12-7-6-11(14)10-5-4-8-15-13(10)12/h1,4-8H,3,9,14H2 |
InChiKey: | InChIKey=ODAPLYCYKOTZJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.