* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHYLNON-1-YN-5-OL |
English Synonyms: | 8-METHYLNON-1-YN-5-OL |
MDL Number.: | MFCD18852169 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)CCC(CCC#C)O |
InChi: | InChI=1S/C10H18O/c1-4-5-6-10(11)8-7-9(2)3/h1,9-11H,5-8H2,2-3H3 |
InChiKey: | InChIKey=AVLQEIQJSKOJEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.