* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-DECANETHIOL |
| CAS: | 56009-26-8 |
| English Synonyms: | DECANE-3-THIOL ; 3-DECANETHIOL |
| MDL Number.: | MFCD18973043 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCCCCC(CC)S |
| InChi: | InChI=1S/C10H22S/c1-3-5-6-7-8-9-10(11)4-2/h10-11H,3-9H2,1-2H3 |
| InChiKey: | InChIKey=UPCYJFLLXDWUOE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.