* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-CHLORO-1-(3-FURANYL)-ETHANONE |
CAS: | 57241-17-5 |
English Synonyms: | ETHANONE, 2-CHLORO-1-(3-FURANYL)- ; 2-CHLORO-1-(3-FURANYL)-ETHANONE |
MDL Number.: | MFCD18974114 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cocc1C(=O)CCl |
InChi: | InChI=1S/C6H5ClO2/c7-3-6(8)5-1-2-9-4-5/h1-2,4H,3H2 |
InChiKey: | InChIKey=YJFXXLDGEROFDM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.